ChemNet > CAS > 55776-17-5 2,6-Dimethoxy-3-nitrobenzoic acid
55776-17-5 2,6-Dimethoxy-3-nitrobenzoic acid
| termék neve |
2,6-Dimethoxy-3-nitrobenzoic acid |
| MF |
C9H9NO6 |
| Molekulatömeg |
227.1709 |
| InChI |
InChI=1/C9H9NO6/c1-15-6-4-3-5(10(13)14)8(16-2)7(6)9(11)12/h3-4H,1-2H3,(H,11,12) |
| CAS-szám |
55776-17-5 |
| EINECS |
259-814-1 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.403g/cm3 |
| Forráspont |
420.7°C at 760 mmHg |
| Törésmutató |
1.569 |
| Gyulladáspont |
208.2°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
