ChemNet > CAS > 6047-91-2 2-Furylglyoxylonitrile
6047-91-2 2-Furylglyoxylonitrile
| termék neve |
2-Furylglyoxylonitrile |
| Szinonimák |
2-Furoyl cyanide; Furylglyoxylonitrile; alpha-Oxo-2-furanacetonitrile; furan-2-yl(oxo)acetonitrile |
| MF |
C6H3NO2 |
| Molekulatömeg |
121.0935 |
| InChI |
InChI=1/C6H3NO2/c7-4-5(8)6-2-1-3-9-6/h1-3H |
| CAS-szám |
6047-91-2 |
| EINECS |
227-944-8 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.246g/cm3 |
| Olvadáspont |
19-87℃ |
| Forráspont |
175.8°C at 760 mmHg |
| Törésmutató |
1.498 |
| Gyulladáspont |
60.1°C |
| Veszély szimbólumok |
 Xn:Harmful;
|
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Biztonsági Leírás |
S36/37:Wear suitable protective clothing and gloves.;
|
|
