ChemNet > CAS > 6258-60-2 4-Methoxybenzyl mercaptan
6258-60-2 4-Methoxybenzyl mercaptan
termék neve |
4-Methoxybenzyl mercaptan |
Szinonimák |
4-Methoxy-alpha-toluenethiol = 4-Methoxybenzyl Mercaptan; 4-Methoxy-alpha-toluenethiol; (4-methoxyphenyl)methanethiol |
MF |
C8H10OS |
Molekulatömeg |
154.2294 |
InChI |
InChI=1/C8H10OS/c1-9-8-4-2-7(6-10)3-5-8/h2-5,10H,6H2,1H3 |
CAS-szám |
6258-60-2 |
EINECS |
228-393-6 |
Molekuláris szerkezete |
|
Sűrűség |
1.072g/cm3 |
Forráspont |
294.5°C at 760 mmHg |
Törésmutató |
1.549 |
Gyulladáspont |
103.4°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|