6973-77-9 N-(1-naftil)maleaminsav
termék neve |
N-(1-naftil)maleaminsav |
Szinonimák |
N-(1-Naftil)maleaminsav; (2Z)-4-(naftalin-1-ilamino)-4-oxobut-2-énsav |
Angol név |
N-(1-Naphthyl)maleamic acid; N-(1-Naphthyl)maleamic acid; (2Z)-4-(naphthalen-1-ylamino)-4-oxobut-2-enoic acid |
MF |
C14H11NO3 |
Molekulatömeg |
241.242 |
InChI |
InChI=1/C14H11NO3/c16-13(8-9-14(17)18)15-12-7-3-5-10-4-1-2-6-11(10)12/h1-9H,(H,15,16)(H,17,18)/b9-8- |
CAS-szám |
6973-77-9 |
Molekuláris szerkezete |
|
Sűrűség |
1.356g/cm3 |
Forráspont |
533.9°C at 760 mmHg |
Törésmutató |
1.706 |
Gyulladáspont |
276.7°C |
Gőznyomás |
3.15E-12mmHg at 25°C |
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|