ChemNet > CAS > 698-90-8 cyclohexylurea
698-90-8 cyclohexylurea
termék neve |
cyclohexylurea |
Szinonimák |
N-CYCLOHEXLUREA; 1-Cyclohexylurea; N-Cyclohexylurea; Cyclohexyl-ure |
MF |
C7H14N2O |
Molekulatömeg |
142.1989 |
InChI |
InChI=1/C7H14N2O/c8-7(10)9-6-4-2-1-3-5-6/h6H,1-5H2,(H3,8,9,10) |
CAS-szám |
698-90-8 |
EINECS |
211-822-6 |
Molekuláris szerkezete |
|
Sűrűség |
1.05g/cm3 |
Forráspont |
240.3°C at 760 mmHg |
Törésmutató |
1.5 |
Gyulladáspont |
99.2°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|