ChemNet > CAS > 7206-70-4 4-Amino-5-chloro-2-methoxybenzoic acid
7206-70-4 4-Amino-5-chloro-2-methoxybenzoic acid
termék neve |
4-Amino-5-chloro-2-methoxybenzoic acid |
Szinonimák |
4-amino-5-chloro-2-methoxybenzoate |
MF |
C8H7ClNO3 |
Molekulatömeg |
200.5996 |
InChI |
InChI=1/C8H8ClNO3/c1-13-7-3-6(10)5(9)2-4(7)8(11)12/h2-3H,10H2,1H3,(H,11,12)/p-1 |
CAS-szám |
7206-70-4 |
EINECS |
230-582-3 |
Molekuláris szerkezete |
|
Olvadáspont |
206-210℃ |
Forráspont |
369.7°C at 760 mmHg |
Gyulladáspont |
177.4°C |
Veszély szimbólumok |
Xn:Harmful;
|
Kockázatot kódok |
R22:Harmful if swallowed.;
|
Biztonsági Leírás |
S28B:After contact with skin, wash immediately with plenty of water and soap.;
S38:In case of insufficient ventilation, wear suitable respiratory equipment.;
|
|