ChemNet > CAS > 84282-78-0 3-chloro-4-fluorophenylhydrazine
84282-78-0 3-chloro-4-fluorophenylhydrazine
termék neve |
3-chloro-4-fluorophenylhydrazine |
MF |
C6H6ClFN2 |
Molekulatömeg |
160.5766 |
InChI |
InChI=1/C6H6ClFN2/c7-5-3-4(10-9)1-2-6(5)8/h1-3,10H,9H2 |
CAS-szám |
84282-78-0 |
Molekuláris szerkezete |
|
Sűrűség |
1.43g/cm3 |
Olvadáspont |
62-63℃ |
Forráspont |
253.1°C at 760 mmHg |
Törésmutató |
1.624 |
Gyulladáspont |
106.9°C |
Veszély szimbólumok |
Xn:Harmful;
|
Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Biztonsági Leírás |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|