ChemNet > CAS > 86-26-0 2-Methoxybiphenyl
86-26-0 2-Methoxybiphenyl
| termék neve |
2-Methoxybiphenyl |
| Szinonimák |
2-Phenylanisole; biphenyl-2-yl methyl ether; o-Methoxybiphenyl |
| MF |
C13H12O |
| Molekulatömeg |
184.2338 |
| InChI |
InChI=1/C13H12O/c1-14-13-10-6-5-9-12(13)11-7-3-2-4-8-11/h2-10H,1H3 |
| CAS-szám |
86-26-0 |
| EINECS |
201-659-9 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.03g/cm3 |
| Olvadáspont |
30-33℃ |
| Forráspont |
274°C at 760 mmHg |
| Törésmutató |
1.556 |
| Gyulladáspont |
101.3°C |
| Veszély szimbólumok |
 Xn:Harmful;
|
| Kockázatot kódok |
R33:Danger of cummulative effects.;
|
| Biztonsági Leírás |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
