ChemNet > CAS > 86-26-0 2-Methoxybiphenyl
86-26-0 2-Methoxybiphenyl
termék neve |
2-Methoxybiphenyl |
Szinonimák |
2-Phenylanisole; biphenyl-2-yl methyl ether; o-Methoxybiphenyl |
MF |
C13H12O |
Molekulatömeg |
184.2338 |
InChI |
InChI=1/C13H12O/c1-14-13-10-6-5-9-12(13)11-7-3-2-4-8-11/h2-10H,1H3 |
CAS-szám |
86-26-0 |
EINECS |
201-659-9 |
Molekuláris szerkezete |
|
Sűrűség |
1.03g/cm3 |
Olvadáspont |
30-33℃ |
Forráspont |
274°C at 760 mmHg |
Törésmutató |
1.556 |
Gyulladáspont |
101.3°C |
Veszély szimbólumok |
Xn:Harmful;
|
Kockázatot kódok |
R33:Danger of cummulative effects.;
|
Biztonsági Leírás |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|