ChemNet > CAS > 10606-72-1 ethyl (R)-(-)-mandelate
10606-72-1 ethyl (R)-(-)-mandelate
Nama produk |
ethyl (R)-(-)-mandelate |
Sinonim |
(-)-Ethyl mandelate; D-(-)-Mandelic acid ethyl ester; (R)-(-)-alpha-Hydroxyphenylacetic acid ethyl ester~(R)-(-)-Mandelic acid ethyl ester; ethyl (2R)-hydroxy(phenyl)ethanoate |
MF |
C10H12O3 |
Berat Molekul |
180.2005 |
InChI |
InChI=1/C10H12O3/c1-2-13-10(12)9(11)8-6-4-3-5-7-8/h3-7,9,11H,2H2,1H3/t9-/m1/s1 |
CAS NO |
10606-72-1 |
Struktur Molekul |
|
Kepadatan |
1.147g/cm3 |
Titik lebur |
33-34℃ |
Titik didih |
254°C at 760 mmHg |
Indeks bias |
1.528 |
Titik nyala |
118.1°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|