ChemNet > CAS > 110763-09-2 5-chloro-1-methyl-1H-pyrazole-4-carbonyl chloride
110763-09-2 5-chloro-1-methyl-1H-pyrazole-4-carbonyl chloride
Nama produk |
5-chloro-1-methyl-1H-pyrazole-4-carbonyl chloride |
MF |
C5H4Cl2N2O |
Berat Molekul |
179.0041 |
InChI |
InChI=1/C5H4Cl2N2O/c1-9-4(6)3(2-8-9)5(7)10/h2H,1H3 |
CAS NO |
110763-09-2 |
Struktur Molekul |
|
Kepadatan |
1.55g/cm3 |
Titik lebur |
52℃ |
Titik didih |
255.4°C at 760 mmHg |
Indeks bias |
1.611 |
Titik nyala |
108.3°C |
Simbol bahaya |
C:Corrosive;
|
Kode Risiko |
R34:Causes burns.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|