ChemNet > CAS > 129332-45-2 methyl 3-amino-4-cyano-5-(methylthio)thiophene-2-carboxylate
129332-45-2 methyl 3-amino-4-cyano-5-(methylthio)thiophene-2-carboxylate
Nama produk |
methyl 3-amino-4-cyano-5-(methylthio)thiophene-2-carboxylate |
Sinonim |
methyl 3-amino-4-cyano-5-(methylsulfanyl)thiophene-2-carboxylate |
MF |
C8H8N2O2S2 |
Berat Molekul |
228.2913 |
InChI |
InChI=1/C8H8N2O2S2/c1-12-7(11)6-5(10)4(3-9)8(13-2)14-6/h10H2,1-2H3 |
CAS NO |
129332-45-2 |
Struktur Molekul |
|
Kepadatan |
1.43g/cm3 |
Titik lebur |
203℃ |
Titik didih |
442.2°C at 760 mmHg |
Indeks bias |
1.63 |
Titik nyala |
221.2°C |
Simbol bahaya |
Xn:Harmful;
|
Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Deskripsi |
S36/37:Wear suitable protective clothing and gloves.;
|
|