ChemNet > CAS > 1569-50-2 3-Penten-2-ol, campuran cis/trans (>
1569-50-2 3-Penten-2-ol, campuran cis/trans (>
| Nama produk |
3-Penten-2-ol, campuran cis/trans (> |
| Sinonim |
90% trans); ; 3-penten-2-ol (cis trans); 3-Penten-2-ol; pent-3-en-2-ol; (2R,3E)-pent-3-en-2-ol; (2S,3E)-pent-3-en-2-ol |
| Nama bahasa Inggris |
3-Penten-2-ol, mixture of cis/trans (>90% trans); 3-penten-2-ol (cis+trans); 3-Penten-2-ol; pent-3-en-2-ol; (2R,3E)-pent-3-en-2-ol; (2S,3E)-pent-3-en-2-ol |
| MF |
C5H10O |
| Berat Molekul |
86.1323 |
| InChI |
InChI=1/C5H10O/c1-3-4-5(2)6/h3-6H,1-2H3/b4-3+/t5-/m0/s1 |
| CAS NO |
1569-50-2 |
| EINECS |
216-376-6 |
| Struktur Molekul |
|
| Kepadatan |
0.839g/cm3 |
| Titik didih |
118.5°C at 760 mmHg |
| Indeks bias |
1.435 |
| Titik nyala |
27.8°C |
| Tekanan uap |
8.18mmHg at 25°C |
| Kode Risiko |
R10:Flammable.;
|
| Keselamatan Deskripsi |
S16:Keep away from sources of ignition - No smoking.;
|
|