ChemNet > CAS > 157373-00-7 3-Chloro-2,4-difluorobenzoyl chloride
157373-00-7 3-Chloro-2,4-difluorobenzoyl chloride
Nama produk |
3-Chloro-2,4-difluorobenzoyl chloride |
MF |
C7H2Cl2F2O |
Berat Molekul |
210.993 |
InChI |
InChI=1/C7H2Cl2F2O/c8-5-4(10)2-1-3(6(5)11)7(9)12/h1-2H |
CAS NO |
157373-00-7 |
Struktur Molekul |
|
Kepadatan |
1.548g/cm3 |
Titik didih |
206.9°C at 760 mmHg |
Indeks bias |
1.519 |
Titik nyala |
78.9°C |
Simbol bahaya |
|
Kode Risiko |
R34:Causes burns.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|