ChemNet > CAS > 1582-24-7 2,3,4,5,6-Pentafluorobenzeneboronic acid
1582-24-7 2,3,4,5,6-Pentafluorobenzeneboronic acid
Nama produk |
2,3,4,5,6-Pentafluorobenzeneboronic acid |
Sinonim |
2,3,4,5,6-Pentafluorophenylboronic acid; Pentafluorophenylboronic acid; (pentafluorophenyl)boronic acid |
MF |
C6H2BF5O2 |
Berat Molekul |
211.8819 |
InChI |
InChI=1/C6H2BF5O2/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h13-14H |
CAS NO |
1582-24-7 |
Struktur Molekul |
|
Kepadatan |
1.61g/cm3 |
Titik didih |
244°C at 760 mmHg |
Indeks bias |
1.429 |
Titik nyala |
101.4°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|