ChemNet > CAS > 175278-41-8 3-(3-nitro-4-tetrahydro-1H-pyrrol-1-ylphenyl)acrylic acid
175278-41-8 3-(3-nitro-4-tetrahydro-1H-pyrrol-1-ylphenyl)acrylic acid
Nama produk |
3-(3-nitro-4-tetrahydro-1H-pyrrol-1-ylphenyl)acrylic acid |
Sinonim |
(2E)-3-(3-nitro-4-pyrrolidin-1-ylphenyl)prop-2-enoic acid |
MF |
C13H14N2O4 |
Berat Molekul |
262.2613 |
InChI |
InChI=1/C13H14N2O4/c16-13(17)6-4-10-3-5-11(12(9-10)15(18)19)14-7-1-2-8-14/h3-6,9H,1-2,7-8H2,(H,16,17)/b6-4+ |
CAS NO |
175278-41-8 |
Struktur Molekul |
|
Kepadatan |
1.37g/cm3 |
Titik lebur |
243℃ |
Titik didih |
483.9°C at 760 mmHg |
Indeks bias |
1.657 |
Titik nyala |
246.5°C |
Simbol bahaya |
Xi:Irritant;
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|