ChemNet > CAS > 18536-91-9 Dodecyltriethoxysilane
18536-91-9 Dodecyltriethoxysilane
Nama produk |
Dodecyltriethoxysilane |
Sinonim |
n-Dodecyltriethoxysilane; n-Diethoxytrethoxysilane; hexadecane-2,15-dione |
MF |
C16H30O2 |
Berat Molekul |
254.4082 |
InChI |
InChI=1/C16H30O2/c1-15(17)13-11-9-7-5-3-4-6-8-10-12-14-16(2)18/h3-14H2,1-2H3 |
CAS NO |
18536-91-9 |
EINECS |
242-409-9 |
Struktur Molekul |
|
Kepadatan |
0.886g/cm3 |
Titik didih |
353.1°C at 760 mmHg |
Indeks bias |
1.444 |
Titik nyala |
132.5°C |
Simbol bahaya |
|
Kode Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|