Nama produk |
4- (2,4-diklorofenoksi) asam butirat, senyawa dengan dimetilamina (1: 1) |
Sinonim |
2,4-DB-dimethylammonium [ISO]; 2,4-DB garam dimethylamine; 2,4-DB-Dimethylammonium; 4- (2,4-Dichlorophenoxy) garam dimethylamine asam butirat; CCRIS 8800; Caswell: Tidak.316C; Kode Kimia Pestisida EPA 030819; 4- (2,4-Dichlorophenoxy) asam butirat, senyawa dengan dimetilamina (1: 1); Asam butanoat, 4- (2,4-diklorofenoksi) -, compd.dengan N-methylmethanamine (1: 1); Asam butirat, 4- (2,4-diklorofenoksi) -, garam dimetilamin; Dimetilamina 4- (2,4-diklorofenoksi) butirat; 4- (2,4-diklorofenoksi) asam butanoat - N-methylmethanamine (1: 1) |
Nama bahasa Inggris |
4-(2,4-dichlorophenoxy)butyric acid, compound with dimethylamine (1:1);2,4-DB-dimethylammonium [ISO]; 2,4-DB dimethylamine salt; 2,4-DB-Dimethylammonium; 4-(2,4-Dichlorophenoxy)butyric acid dimethylamine salt; CCRIS 8800; Caswell No. 316C; EPA Pesticide Chemical Code 030819; 4-(2,4-Dichlorophenoxy)butyric acid, compound with dimethylamine (1:1); Butanoic acid, 4-(2,4-dichlorophenoxy)-, compd. with N-methylmethanamine (1:1); Butyric acid, 4-(2,4-dichlorophenoxy)-, dimethylamine salt; Dimethylamine 4-(2,4-dichlorophenoxy)butyrate; 4-(2,4-dichlorophenoxy)butanoic acid - N-methylmethanamine (1:1) |
MF |
C12H17Cl2NO3 |
Berat Molekul |
294.1743 |
InChI |
InChI=1/C10H10Cl2O3.C2H7N/c11-7-3-4-9(8(12)6-7)15-5-1-2-10(13)14;1-3-2/h3-4,6H,1-2,5H2,(H,13,14);3H,1-2H3 |
CAS NO |
2758-42-1 |
EINECS |
220-422-0 |
Struktur Molekul |
|
Titik didih |
410.4°C at 760 mmHg |
Titik nyala |
202°C |
Tekanan uap |
1.8E-07mmHg at 25°C |
|