ChemNet > CAS > 28741-08-4 n-Octylboronic acid
28741-08-4 n-Octylboronic acid
Nama produk |
n-Octylboronic acid |
Sinonim |
Caprylboronic acid; n-Octaneboronic acid; octylboronic acid; 1-Octylboronic acid |
MF |
C8H19BO2 |
Berat Molekul |
158.0463 |
InChI |
InChI=1/C8H19BO2/c1-2-3-4-5-6-7-8-9(10)11/h10-11H,2-8H2,1H3 |
CAS NO |
28741-08-4 |
Struktur Molekul |
|
Kepadatan |
0.89g/cm3 |
Titik didih |
262.6°C at 760 mmHg |
Indeks bias |
1.427 |
Titik nyala |
112.6°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|