CAS No: 29584-42-7, Chemical Name: sulfur trioxide dimethylformamide complex
Chemical CAS Database with Global Chemical Suppliers - ChemNet
the physical and chemical property of 29584-42-7, sulfur trioxide dimethylformamide complex is provided by ChemNet.com

  ChemNet > CAS > 29584-42-7 sulfur trioxide dimethylformamide complex

29584-42-7 sulfur trioxide dimethylformamide complex

Nama produk sulfur trioxide dimethylformamide complex
Sinonim N,N-dimethylformamide-oxosulfane dioxide (1:1)
MF C3H7NO4S
Berat Molekul 153.157
InChI InChI=1/C3H7NO.O3S/c1-4(2)3-5;1-4(2)3/h3H,1-2H3;
CAS NO 29584-42-7
EINECS 249-701-5
Struktur Molekul 29584-42-7 sulfur trioxide dimethylformamide complex
Titik lebur 155-158℃
Titik didih 153°C at 760 mmHg
Titik nyala 57.8°C
Simbol bahaya
Kode Risiko
Keselamatan Deskripsi