ChemNet > CAS > 345-70-0 3,3'-difluorobenzophenone
345-70-0 3,3'-difluorobenzophenone
Nama produk |
3,3'-difluorobenzophenone |
Sinonim |
bis(3-fluorophenyl)methanone |
MF |
C13H8F2O |
Berat Molekul |
218.1988 |
InChI |
InChI=1/C13H8F2O/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H |
CAS NO |
345-70-0 |
Struktur Molekul |
|
Kepadatan |
1.239g/cm3 |
Titik lebur |
56-59℃ |
Titik didih |
316.2°C at 760 mmHg |
Indeks bias |
1.549 |
Titik nyala |
121.3°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|