ChemNet > CAS > 47230-38-6 Diethyl biphenyl-4,4′-dicarboxylate
47230-38-6 Diethyl biphenyl-4,4′-dicarboxylate
Nama produk |
Diethyl biphenyl-4,4′-dicarboxylate |
Sinonim |
Diethyl biphenyl-4,4-dicarboxylate; 4,4-Biphenyldicarboxylic acid diethyl ester |
MF |
C18H18O4 |
Berat Molekul |
298.3331 |
InChI |
InChI=1/C18H18O4/c1-3-21-17(19)15-9-5-13(6-10-15)14-7-11-16(12-8-14)18(20)22-4-2/h5-12H,3-4H2,1-2H3 |
CAS NO |
47230-38-6 |
Struktur Molekul |
|
Kepadatan |
1.132g/cm3 |
Titik lebur |
111-113℃ |
Titik didih |
431.3°C at 760 mmHg |
Indeks bias |
1.547 |
Titik nyala |
215°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|