ChemNet > CAS > 51980-54-2 4-(1-Pyrrolidinyl)-benzaldehyde
51980-54-2 4-(1-Pyrrolidinyl)-benzaldehyde
Nama produk |
4-(1-Pyrrolidinyl)-benzaldehyde |
Sinonim |
4-(1-Pyrrolidino)benzaldehyde; 4-(pyrrolidin-1-yl)benzaldehyde |
MF |
C11H13NO |
Berat Molekul |
175.227 |
InChI |
InChI=1/C11H13NO/c13-9-10-3-5-11(6-4-10)12-7-1-2-8-12/h3-6,9H,1-2,7-8H2 |
CAS NO |
51980-54-2 |
EINECS |
257-570-0 |
Struktur Molekul |
|
Kepadatan |
1.125g/cm3 |
Titik didih |
329.4°C at 760 mmHg |
Indeks bias |
1.599 |
Titik nyala |
134.3°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|