ChemNet > CAS > 5307-17-5 Methyl 3-methoxy-2-nitrobenzoate
5307-17-5 Methyl 3-methoxy-2-nitrobenzoate
Nama produk |
Methyl 3-methoxy-2-nitrobenzoate |
Sinonim |
3-Methoxy-2-nitrobenzoic acid methyl ester; 3-Methoxy-2-nitromethylbenzoate |
MF |
C9H9NO5 |
Berat Molekul |
211.1715 |
InChI |
InChI=1/C9H9NO5/c1-14-7-5-3-4-6(9(11)15-2)8(7)10(12)13/h3-5H,1-2H3 |
CAS NO |
5307-17-5 |
Struktur Molekul |
|
Kepadatan |
1.294g/cm3 |
Titik didih |
325.4°C at 760 mmHg |
Indeks bias |
1.54 |
Titik nyala |
151.5°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|