ChemNet > CAS > 5676-81-3 N-(4-Fluorobenzylidene)aniline
5676-81-3 N-(4-Fluorobenzylidene)aniline
Nama produk |
N-(4-Fluorobenzylidene)aniline |
MF |
C13H10FN |
Berat Molekul |
199.2236 |
InChI |
InChI=1/C13H10FN/c14-12-8-6-11(7-9-12)10-15-13-4-2-1-3-5-13/h1-10H |
CAS NO |
5676-81-3 |
Struktur Molekul |
|
Kepadatan |
1.035g/cm3 |
Titik lebur |
40℃ |
Titik didih |
296.169°C at 760 mmHg |
Indeks bias |
1.539 |
Titik nyala |
132.919°C |
Simbol bahaya |
Xn:Harmful;
|
Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Deskripsi |
S36/37:Wear suitable protective clothing and gloves.;
|
|