ChemNet > CAS > 720-75-2 Methyl 4-biphenylcarboxylate
720-75-2 Methyl 4-biphenylcarboxylate
Nama produk |
Methyl 4-biphenylcarboxylate |
Sinonim |
P-phenylbenzoic acid methyl ester; p-Phenylbenzoic acid-OMe; Methyl 4-Phenylbenzoate; 4-Biphenylcarboxylic acid methyl ester~Methyl 4-phenylbenzoate; methyl biphenyl-4-carboxylate; methyl 4-phenylcyclohexanecarboxylate |
MF |
C14H18O2 |
Berat Molekul |
218.2915 |
InChI |
InChI=1/C14H18O2/c1-16-14(15)13-9-7-12(8-10-13)11-5-3-2-4-6-11/h2-6,12-13H,7-10H2,1H3 |
CAS NO |
720-75-2 |
EINECS |
211-954-4 |
Struktur Molekul |
|
Kepadatan |
1.048g/cm3 |
Titik lebur |
118℃ |
Titik didih |
307.8°C at 760 mmHg |
Indeks bias |
1.517 |
Titik nyala |
132.7°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|