ChemNet > CAS > 7466-54-8 2-Methoxybenzhydrazide
7466-54-8 2-Methoxybenzhydrazide
Nama produk |
2-Methoxybenzhydrazide |
Sinonim |
o-Anisic hydrazide; 2-methoxybenzohydrazide |
MF |
C8H10N2O2 |
Berat Molekul |
166.1772 |
InChI |
InChI=1/C8H10N2O2/c1-12-7-5-3-2-4-6(7)8(11)10-9/h2-5H,9H2,1H3,(H,10,11) |
CAS NO |
7466-54-8 |
EINECS |
231-260-5 |
Struktur Molekul |
|
Kepadatan |
1.178g/cm3 |
Indeks bias |
1.558 |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|