ChemNet > CAS > 87223-76-5 etil 2- (2-sianoanilino) asetat
87223-76-5 etil 2- (2-sianoanilino) asetat
| Nama produk |
etil 2- (2-sianoanilino) asetat |
| Sinonim |
etil N- (2-sianofenil) glisinat |
| Nama bahasa Inggris |
ethyl 2-(2-cyanoanilino)acetate;ethyl N-(2-cyanophenyl)glycinate |
| MF |
C11H12N2O2 |
| Berat Molekul |
204.2252 |
| InChI |
InChI=1/C11H12N2O2/c1-2-15-11(14)8-13-10-6-4-3-5-9(10)7-12/h3-6,13H,2,8H2,1H3 |
| CAS NO |
87223-76-5 |
| Struktur Molekul |
|
| Kepadatan |
1.15g/cm3 |
| Titik didih |
351.1°C at 760 mmHg |
| Indeks bias |
1.538 |
| Titik nyala |
166.1°C |
| Tekanan uap |
4.2E-05mmHg at 25°C |
| Simbol bahaya |
Xn:Harmful;
|
| Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Deskripsi |
S36/37:Wear suitable protective clothing and gloves.;
|
|