CAS No: 91465-71-3, Chemical Name: 1,2,3,4,4a,5,8,8a-octahydro-1,4-methanonaphthalene
the physical and chemical property of 91465-71-3, 1,2,3,4,4a,5,8,8a-octahydro-1,4-methanonaphthalene is provided by ChemNet.com
ChemNet > CAS > 91465-71-3 1,2,3,4,4a,5,8,8a-octahydro-1,4-methanonaphthalene
91465-71-3 1,2,3,4,4a,5,8,8a-octahydro-1,4-methanonaphthalene
Nama produk |
1,2,3,4,4a,5,8,8a-octahydro-1,4-methanonaphthalene |
Sinonim |
1,4-methanonaphthalene, 1,2,3,4,4a,5,8,8a-octahydro-; Tricyclo(6.2.1.0(2,7))undec-4-ene; Tricyclo[6.2.1.0~2,7~]undec-4-ene |
MF |
C11H16 |
Berat Molekul |
148.2447 |
InChI |
InChI=1/C11H16/c1-2-4-11-9-6-5-8(7-9)10(11)3-1/h1-2,8-11H,3-7H2 |
CAS NO |
91465-71-3 |
Struktur Molekul |
|
Kepadatan |
0.985g/cm3 |
Titik didih |
208.8°C at 760 mmHg |
Indeks bias |
1.529 |
Titik nyala |
70.6°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
|
|