ChemNet > CAS > 959-22-8 4-Nitrophenyl benzoate
959-22-8 4-Nitrophenyl benzoate
Nama produk |
4-Nitrophenyl benzoate |
Sinonim |
Benzoic acid 4-nitrophenyl ester |
MF |
C13H9NO4 |
Berat Molekul |
243.2149 |
InChI |
InChI=1/C13H9NO4/c15-13(10-4-2-1-3-5-10)18-12-8-6-11(7-9-12)14(16)17/h1-9H |
CAS NO |
959-22-8 |
Struktur Molekul |
|
Kepadatan |
1.316g/cm3 |
Titik didih |
399.5°C at 760 mmHg |
Indeks bias |
1.614 |
Titik nyala |
183.5°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|