ChemNet > CAS > 14294-09-8 1-Piperidinethiocarboxamide
14294-09-8 1-Piperidinethiocarboxamide
שם המוצר |
1-Piperidinethiocarboxamide |
נרדפות |
piperidine-1-carbothioamide |
מולקולרית פורמולה |
C6H12N2S |
משקל מולקולרי |
144.2379 |
InChI |
InChI=1/C6H12N2S/c7-6(9)8-4-2-1-3-5-8/h1-5H2,(H2,7,9) |
מספר CAS |
14294-09-8 |
מבנה מולקולרי |
|
צפיפות |
1.165g/cm3 |
נקודת רתיחה |
237.3°C at 760 mmHg |
משקל סגולי |
1.593 |
נקודת הבזק |
97.3°C |
Hazard סימנים |
|
סיכונים קודי |
R20/22:Harmful by inhalation and if swallowed.;
|
בטיחות תיאור |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|