ChemNet > CAS > 1720-32-7 1,6-Diphenyl-1,3,5-hexatriene
1720-32-7 1,6-Diphenyl-1,3,5-hexatriene
שם המוצר |
1,6-Diphenyl-1,3,5-hexatriene |
נרדפות |
DPH; 1,1'-hexa-1,3,5-triene-1,6-diyldibenzene; 1,1'-(1E,3E,5E)-hexa-1,3,5-triene-1,6-diyldibenzene; 1-phenylhexa-1,3,5-trienylbenzene |
מולקולרית פורמולה |
C18H16 |
משקל מולקולרי |
232.3196 |
InChI |
InChI=1/C18H16/c1-2-3-6-15-18(16-11-7-4-8-12-16)17-13-9-5-10-14-17/h2-15H,1H2 |
מספר CAS |
1720-32-7 |
EINECS |
217-011-3 |
מבנה מולקולרי |
|
צפיפות |
0.988g/cm3 |
נקודת ההתוך |
199-203℃ |
נקודת רתיחה |
361°C at 760 mmHg |
משקל סגולי |
1.585 |
נקודת הבזק |
185.3°C |
Hazard סימנים |
|
סיכונים קודי |
|
בטיחות תיאור |
S24/25:Avoid contact with skin and eyes.;
|
|