ChemNet > CAS > 17249-79-5;17249-29-5 2,3-Dichlorothiophene
17249-79-5;17249-29-5 2,3-Dichlorothiophene
| שם המוצר |
2,3-Dichlorothiophene |
| נרדפות |
2,3-dichloro-thiophene |
| מולקולרית פורמולה |
C4H2Cl2S |
| משקל מולקולרי |
153.0297 |
| InChI |
InChI=1/C4H2Cl2S/c5-3-1-2-7-4(3)6/h1-2H |
| מספר CAS |
17249-79-5;17249-29-5 |
| מבנה מולקולרי |
|
| צפיפות |
1.488g/cm3 |
| נקודת ההתוך |
-26℃ |
| נקודת רתיחה |
170.7°C at 760 mmHg |
| משקל סגולי |
1.584 |
| נקודת הבזק |
68.9°C |
| Hazard סימנים |
|
| סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| בטיחות תיאור |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
