ChemNet > CAS > 173963-93-4 (S)-N-FMOC-4-Cyanophenylalanine
173963-93-4 (S)-N-FMOC-4-Cyanophenylalanine
שם המוצר |
(S)-N-FMOC-4-Cyanophenylalanine |
נרדפות |
Fmoc-L-4-Cyanophenylalanine; Fmoc-4-Cyano-L-phenylalanine; Fmoc-Phe(4-CN)-OH |
מולקולרית פורמולה |
C25H20N2O4 |
משקל מולקולרי |
412.4373 |
InChI |
InChI=1/C25H20N2O4/c26-14-17-11-9-16(10-12-17)13-23(24(28)29)27-25(30)31-15-22-20-7-3-1-5-18(20)19-6-2-4-8-21(19)22/h1-12,22-23H,13,15H2,(H,27,30)(H,28,29)/t23-/m0/s1 |
מספר CAS |
173963-93-4 |
מבנה מולקולרי |
|
צפיפות |
1.35g/cm3 |
נקודת ההתוך |
189℃ |
נקודת רתיחה |
678.7°C at 760 mmHg |
משקל סגולי |
1.672 |
נקודת הבזק |
364.3°C |
Hazard סימנים |
Xn:Harmful;
|
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S36/37:Wear suitable protective clothing and gloves.;
|
|