ChemNet > CAS > 18719-43-2 diethyl (3-chloropropyl)malonate
18719-43-2 diethyl (3-chloropropyl)malonate
| שם המוצר |
diethyl (3-chloropropyl)malonate |
| נרדפות |
(3-Chloropropyl)malonic acid diethyl ester; diethyl (3-chloropropyl)propanedioate |
| מולקולרית פורמולה |
C10H17ClO4 |
| משקל מולקולרי |
236.6926 |
| InChI |
InChI=1/C10H17ClO4/c1-3-14-9(12)8(6-5-7-11)10(13)15-4-2/h8H,3-7H2,1-2H3 |
| מספר CAS |
18719-43-2 |
| מבנה מולקולרי |
|
| צפיפות |
1.114g/cm3 |
| נקודת רתיחה |
290.2°C at 760 mmHg |
| משקל סגולי |
1.447 |
| נקודת הבזק |
111.9°C |
| Hazard סימנים |
|
| סיכונים קודי |
R36/38:Irritating to eyes and skin.;
|
| בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
