ChemNet > CAS > 206559-36-6 3-Benzyloxyphenyl isothiocyanate
206559-36-6 3-Benzyloxyphenyl isothiocyanate
| שם המוצר |
3-Benzyloxyphenyl isothiocyanate |
| נרדפות |
1-(benzyloxy)-3-isothiocyanatobenzene |
| מולקולרית פורמולה |
C14H11NOS |
| משקל מולקולרי |
241.3082 |
| InChI |
InChI=1/C14H11NOS/c17-11-15-13-7-4-8-14(9-13)16-10-12-5-2-1-3-6-12/h1-9H,10H2 |
| מספר CAS |
206559-36-6 |
| מבנה מולקולרי |
|
| צפיפות |
1.09g/cm3 |
| נקודת רתיחה |
398.3°C at 760 mmHg |
| משקל סגולי |
1.582 |
| נקודת הבזק |
194.7°C |
| Hazard סימנים |
|
| סיכונים קודי |
R20/22:Harmful by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
