ChemNet > CAS > 3128-07-2 5-Acetylvaleric acid
3128-07-2 5-Acetylvaleric acid
| שם המוצר |
5-Acetylvaleric acid |
| נרדפות |
6-Oxoheptanoic acid; 6-Ketoheptanoic acid~6-Oxoheptanoic acid; 6-oxoheptanoate; 6-Oxoenanthic acid |
| מולקולרית פורמולה |
C7H11O3 |
| משקל מולקולרי |
143.161 |
| InChI |
InChI=1/C7H12O3/c1-6(8)4-2-3-5-7(9)10/h2-5H2,1H3,(H,9,10)/p-1 |
| מספר CAS |
3128-07-2 |
| EINECS |
221-512-2 |
| מבנה מולקולרי |
|
| נקודת ההתוך |
34-140℃ |
| נקודת רתיחה |
299.3°C at 760 mmHg |
| נקודת הבזק |
149.1°C |
| Hazard סימנים |
|
| סיכונים קודי |
R34:Causes burns.;
|
| בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
