ChemNet > CAS > 3529-82-6 3-nitrophenyl isothiocyanate
3529-82-6 3-nitrophenyl isothiocyanate
| שם המוצר |
3-nitrophenyl isothiocyanate |
| נרדפות |
3-Isothiocyanatonitrobenzene; 1-isothiocyanato-3-nitrobenzene |
| מולקולרית פורמולה |
C7H4N2O2S |
| משקל מולקולרי |
180.1839 |
| InChI |
InChI=1/C7H4N2O2S/c10-9(11)7-3-1-2-6(4-7)8-5-12/h1-4H |
| מספר CAS |
3529-82-6 |
| מבנה מולקולרי |
|
| צפיפות |
1.33g/cm3 |
| נקודת ההתוך |
57-60℃ |
| נקודת רתיחה |
317.8°C at 760 mmHg |
| משקל סגולי |
1.631 |
| נקודת הבזק |
146°C |
| Hazard סימנים |
|
| סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
