ChemNet > CAS > 41927-01-9 3,4-Dimethyl-o-phenylenediamine
41927-01-9 3,4-Dimethyl-o-phenylenediamine
| שם המוצר |
3,4-Dimethyl-o-phenylenediamine |
| נרדפות |
3,4-Diamino-o-xylene = 3,4-Dimethylphenylenediamine; 3,4-dimethylbenzene-1,2-diamine |
| מולקולרית פורמולה |
C8H12N2 |
| משקל מולקולרי |
136.1943 |
| InChI |
InChI=1/C8H12N2/c1-5-3-4-7(9)8(10)6(5)2/h3-4H,9-10H2,1-2H3 |
| מספר CAS |
41927-01-9 |
| מבנה מולקולרי |
|
| צפיפות |
1.076g/cm3 |
| נקודת רתיחה |
278.3°C at 760 mmHg |
| משקל סגולי |
1.618 |
| נקודת הבזק |
143.9°C |
| Hazard סימנים |
|
| סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| בטיחות תיאור |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
