ChemNet > CAS > 6047-91-2 2-Furylglyoxylonitrile
6047-91-2 2-Furylglyoxylonitrile
| שם המוצר |
2-Furylglyoxylonitrile |
| נרדפות |
2-Furoyl cyanide; Furylglyoxylonitrile; alpha-Oxo-2-furanacetonitrile; furan-2-yl(oxo)acetonitrile |
| מולקולרית פורמולה |
C6H3NO2 |
| משקל מולקולרי |
121.0935 |
| InChI |
InChI=1/C6H3NO2/c7-4-5(8)6-2-1-3-9-6/h1-3H |
| מספר CAS |
6047-91-2 |
| EINECS |
227-944-8 |
| מבנה מולקולרי |
|
| צפיפות |
1.246g/cm3 |
| נקודת ההתוך |
19-87℃ |
| נקודת רתיחה |
175.8°C at 760 mmHg |
| משקל סגולי |
1.498 |
| נקודת הבזק |
60.1°C |
| Hazard סימנים |
 Xn:Harmful;
|
| סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| בטיחות תיאור |
S36/37:Wear suitable protective clothing and gloves.;
|
|
