ChemNet > CAS > 6496-89-5 2,4-Dimethoxyphenylacetic acid
6496-89-5 2,4-Dimethoxyphenylacetic acid
שם המוצר |
2,4-Dimethoxyphenylacetic acid |
נרדפות |
(2,4-dimethoxyphenyl)acetate |
מולקולרית פורמולה |
C10H12O4 |
משקל מולקולרי |
195.1925 |
InChI |
InChI=1/C10H12O4/c1-13-8-4-3-7(5-10(11)12)9(6-8)14-2/h3-4,6H,5H2,1-2H3,(H,11,12)/p-1 |
מספר CAS |
6496-89-5 |
מבנה מולקולרי |
|
נקודת ההתוך |
110-113℃ |
נקודת רתיחה |
339.7°C at 760 mmHg |
נקודת הבזק |
134.1°C |
Hazard סימנים |
Xn:Harmful;
|
סיכונים קודי |
R22:;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|