שם המוצר |
L-חומצה גלוטמית, N-קוקו acyl נגזרות., compds.with triethanolamine (1: 1) |
נרדפות |
L-חומצה גלוטמית, N-coco acyl נגזרות., compds.עם triethanolamine; תה-קוקויל גלוטמט; טריאתנולמין קוקואיל גלוטמט; N-Cocoyl-L-חומצה גלוטמית, מונו(triethanolamine) מלח; L-חומצה גלוטמית, N-coco acyl נגזרות., compds.עם טריאתנולמין (1:1); L-חומצה גלוטמית, N-קוקו acyl נגזרות., compds.with triethanolamine(1: 1) |
שם אנגלי |
l-Glutamic acid, N-coco acyl derivs., compds. with triethanolamine (1:1); L-Glutamic acid, N-coco acyl derivs., compds. with triethanolamine; TEA-Cocoyl glutamate; Triethanolamine cocoyl glutamate; N-Cocoyl-L-glutamic acid, mono(triethanolamine) salt; L-Glutamic acid, N-coco acyl derivs., compds. with triethanolamine (1:1); l-Glutamic acid, N-coco acyl derivs., compds. with triethanolamine(1:1); l-Glutamic acid,N-coco acyl derivs.,compds. with triethanolamine(1:1);
|
מולקולרית פורמולה |
C6H15NO3・C5H9NO4 |
משקל מולקולרי |
296.318 |
InChI |
InChI=1/C6H15NO3.C5H9NO4/c8-4-1-7(2-5-9)3-6-10;6-3(5(9)10)1-2-4(7)8/h8-10H,1-6H2;3H,1-2,6H2,(H,7,8)(H,9,10)/t;3-/m.0/s1 |
מספר CAS |
68187-29-1 |
EINECS |
269-084-6 |
מבנה מולקולרי |
|
|