ChemNet > CAS > 68295-45-4 (R)-(-)-2-(Anilinomethyl)pyrrolidine
68295-45-4 (R)-(-)-2-(Anilinomethyl)pyrrolidine
שם המוצר |
(R)-(-)-2-(Anilinomethyl)pyrrolidine |
נרדפות |
N-[(2R)-pyrrolidin-2-ylmethyl]aniline |
מולקולרית פורמולה |
C11H16N2 |
משקל מולקולרי |
176.2581 |
InChI |
InChI=1/C11H16N2/c1-2-5-10(6-3-1)13-9-11-7-4-8-12-11/h1-3,5-6,11-13H,4,7-9H2/t11-/m1/s1 |
מספר CAS |
68295-45-4 |
מבנה מולקולרי |
|
צפיפות |
1.038g/cm3 |
נקודת רתיחה |
311°C at 760 mmHg |
משקל סגולי |
1.57 |
נקודת הבזק |
184.3°C |
Hazard סימנים |
|
סיכונים קודי |
R34:Causes burns.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|