ChemNet > CAS > 1070-62-8 Ethyl hydrogen glutarate
1070-62-8 Ethyl hydrogen glutarate
उत्पाद का नाम |
Ethyl hydrogen glutarate |
समानार्थी |
Glutaric acid monoethyl ester~Monoethyl glutarate~Pentanedioic acid monoethyl ester; 5-ethoxy-5-oxopentanoic acid; monoethyl pentanedioate |
आणविक फार्मूला |
C7H12O4 |
आण्विक वजन |
160.1678 |
InChI |
InChI=1/C7H12O4/c1-2-11-7(10)5-3-4-6(8)9/h2-5H2,1H3,(H,8,9) |
कैस रजिस्टी संख्या |
1070-62-8 |
EINECS |
213-977-5 |
आणविक संरचना |
|
घनत्व |
1.126g/cm3 |
उबलने का समय |
280°C at 760 mmHg |
अपवर्तक सूचकांक |
1.444 |
फ्लैश प्वाइंट |
112.5°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/38:Irritating to eyes and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|