ChemNet > CAS > 1195-52-4 3-(3-Thienyl)acrylic acid
1195-52-4 3-(3-Thienyl)acrylic acid
उत्पाद का नाम |
3-(3-Thienyl)acrylic acid |
समानार्थी |
Thiophene-3-acrylic acid; (2E)-3-thiophen-3-ylprop-2-enoate; (2Z)-3-(thiophen-3-yl)prop-2-enoic acid |
आणविक फार्मूला |
C7H6O2S |
आण्विक वजन |
154.1863 |
InChI |
InChI=1/C7H6O2S/c8-7(9)2-1-6-3-4-10-5-6/h1-5H,(H,8,9)/b2-1- |
कैस रजिस्टी संख्या |
1195-52-4 |
EINECS |
214-800-4 |
आणविक संरचना |
|
घनत्व |
1.346g/cm3 |
उबलने का समय |
298.896°C at 760 mmHg |
अपवर्तक सूचकांक |
1.656 |
फ्लैश प्वाइंट |
134.568°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|