ChemNet > CAS > 14294-09-8 1-Piperidinethiocarboxamide
14294-09-8 1-Piperidinethiocarboxamide
| उत्पाद का नाम |
1-Piperidinethiocarboxamide |
| समानार्थी |
piperidine-1-carbothioamide |
| आणविक फार्मूला |
C6H12N2S |
| आण्विक वजन |
144.2379 |
| InChI |
InChI=1/C6H12N2S/c7-6(9)8-4-2-1-3-5-8/h1-5H2,(H2,7,9) |
| कैस रजिस्टी संख्या |
14294-09-8 |
| आणविक संरचना |
|
| घनत्व |
1.165g/cm3 |
| उबलने का समय |
237.3°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.593 |
| फ्लैश प्वाइंट |
97.3°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R20/22:Harmful by inhalation and if swallowed.;
|
| सुरक्षा विवरण |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
