ChemNet > CAS > 144284-25-3 2,4,5-trifluorobenzyl alcohol
144284-25-3 2,4,5-trifluorobenzyl alcohol
उत्पाद का नाम |
2,4,5-trifluorobenzyl alcohol |
समानार्थी |
(2,4,5-trifluorophenyl)methanol |
आणविक फार्मूला |
C7H5F3O |
आण्विक वजन |
162.11 |
InChI |
InChI=1/C6H3BrF2O/c7-3-1-2-4(10)6(9)5(3)8/h1-2,10H |
कैस रजिस्टी संख्या |
144284-25-3 |
आणविक संरचना |
|
घनत्व |
1.858g/cm3 |
उबलने का समय |
213.308°C at 760 mmHg |
अपवर्तक सूचकांक |
1.55 |
फ्लैश प्वाइंट |
82.806°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/38:Irritating to eyes and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|