ChemNet > CAS > 17249-79-5;17249-29-5 2,3-Dichlorothiophene
17249-79-5;17249-29-5 2,3-Dichlorothiophene
| उत्पाद का नाम |
2,3-Dichlorothiophene |
| समानार्थी |
2,3-dichloro-thiophene |
| आणविक फार्मूला |
C4H2Cl2S |
| आण्विक वजन |
153.0297 |
| InChI |
InChI=1/C4H2Cl2S/c5-3-1-2-7-4(3)6/h1-2H |
| कैस रजिस्टी संख्या |
17249-79-5;17249-29-5 |
| आणविक संरचना |
|
| घनत्व |
1.488g/cm3 |
| गलनांक |
-26℃ |
| उबलने का समय |
170.7°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.584 |
| फ्लैश प्वाइंट |
68.9°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| सुरक्षा विवरण |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
