ChemNet > CAS > 17249-79-5;17249-29-5 2,3-Dichlorothiophene
17249-79-5;17249-29-5 2,3-Dichlorothiophene
उत्पाद का नाम |
2,3-Dichlorothiophene |
समानार्थी |
2,3-dichloro-thiophene |
आणविक फार्मूला |
C4H2Cl2S |
आण्विक वजन |
153.0297 |
InChI |
InChI=1/C4H2Cl2S/c5-3-1-2-7-4(3)6/h1-2H |
कैस रजिस्टी संख्या |
17249-79-5;17249-29-5 |
आणविक संरचना |
|
घनत्व |
1.488g/cm3 |
गलनांक |
-26℃ |
उबलने का समय |
170.7°C at 760 mmHg |
अपवर्तक सूचकांक |
1.584 |
फ्लैश प्वाइंट |
68.9°C |
खतरा प्रतीक |
|
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
सुरक्षा विवरण |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|