ChemNet > CAS > 207974-17-2 2,6-Difluorophenyl isothiocyanate
207974-17-2 2,6-Difluorophenyl isothiocyanate
| उत्पाद का नाम |
2,6-Difluorophenyl isothiocyanate |
| समानार्थी |
1,3-difluoro-2-isocyanatobenzene |
| आणविक फार्मूला |
C7H3F2NO |
| आण्विक वजन |
155.1016 |
| InChI |
InChI=1/C7H3F2NO/c8-5-2-1-3-6(9)7(5)10-4-11/h1-3H |
| कैस रजिस्टी संख्या |
207974-17-2 |
| आणविक संरचना |
|
| घनत्व |
1.24g/cm3 |
| उबलने का समय |
174.4°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.488 |
| फ्लैश प्वाइंट |
51.5°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
