ChemNet > CAS > 220227-37-2 3,4,5-trifluorobenzyl alcohol
220227-37-2 3,4,5-trifluorobenzyl alcohol
उत्पाद का नाम |
3,4,5-trifluorobenzyl alcohol |
समानार्थी |
3,4,5-trifluorobenzenemethanol; (3,4,5-trifluorophenyl)methanol |
आणविक फार्मूला |
C7H5F3O |
आण्विक वजन |
162.1092 |
InChI |
InChI=1/C7H5F3O/c8-5-1-4(3-11)2-6(9)7(5)10/h1-2,11H,3H2 |
कैस रजिस्टी संख्या |
220227-37-2 |
आणविक संरचना |
|
घनत्व |
1.398g/cm3 |
उबलने का समय |
192.1°C at 760 mmHg |
अपवर्तक सूचकांक |
1.476 |
फ्लैश प्वाइंट |
83°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|