ChemNet > CAS > 22355-34-6 benzoic acid, compound with dicyclohexylamine (1:1)
22355-34-6 benzoic acid, compound with dicyclohexylamine (1:1)
| उत्पाद का नाम |
benzoic acid, compound with dicyclohexylamine (1:1) |
| समानार्थी |
Benzoic acid, compd. with N-cyclohexylcyclohexanamine (1:1); Benzoic acid dicyclohexylamine salt; Dicyclohexylamine benzoate; Dicyclohexylammonium benzoate; Benzoic acid, compd. with dicyclohexylamine (1:1) (8CI); Benzoic acid, compound with dicyclohexylamine (1:1); Dicyclohexylamine, compd. with benzoic acid (7CI); N-cyclohexylcyclohexanamine benzoate (1:1) |
| आणविक फार्मूला |
C19H29NO2 |
| आण्विक वजन |
303.4391 |
| InChI |
InChI=1/C12H23N.C7H6O2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;8-7(9)6-4-2-1-3-5-6/h11-13H,1-10H2;1-5H,(H,8,9) |
| कैस रजिस्टी संख्या |
22355-34-6 |
| EINECS |
244-932-8 |
| आणविक संरचना |
|
| उबलने का समय |
256.1°C at 760 mmHg |
| फ्लैश प्वाइंट |
96.1°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
|
| सुरक्षा विवरण |
|
|
